C18H24N4O3 — CID 142496039
tert-butyl 2-(3-carbamoyl-5-pyrrolidin-1-ylindazol-1-yl)acetate (PubChem CID 142496039) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is tert-butyl 2-(3-carbamoyl-5-pyrrolidin-1-ylindazol-1-yl)acetate.
| Compound Name | tert-butyl 2-(3-carbamoyl-5-pyrrolidin-1-ylindazol-1-yl)acetate |
|---|---|
| PubChem CID | 142496039 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | tert-butyl 2-(3-carbamoyl-5-pyrrolidin-1-ylindazol-1-yl)acetate |
| SMILES | CC(C)(C)OC(=O)Cn1nc(C(N)=O)c2cc(N3CCCC3)ccc21 |
| InChI | InChI=1S/C18H24N4O3/c1-18(2,3)25-15(23)11-22-14-7-6-12(21-8-4-5-9-21)10-13(14)16(20-22)17(19)24/h6-7,10H,4-5,8-9,11H2,1-3H3,(H2,19,24) |
| InChIKey | CHENZZKXNIMMIF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |