About 2-hydroxyethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate
2-hydroxyethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate (PubChem CID 61322565) has the molecular formula C9H15N3O3
and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-hydroxyethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate.
Analyze 2-hydroxyethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate?
The IUPAC name of 2-hydroxyethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate (CID 61322565) is 2-hydroxyethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate.
What is the SMILES notation for 2-hydroxyethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate?
The canonical SMILES for 2-hydroxyethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate is Cc1nn(CC(=O)OCCO)c(C)c1N.
What is the InChIKey of 2-hydroxyethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate?
The InChIKey is NOBKWHIXSJTCDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3/c1-6-9(10)7(2)12(11-6)5-8(14)15-4-3-13/h13H,3-5,10H2,1-2H3.
What are the key properties of 2-hydroxyethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate?
2-hydroxyethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate has a molecular weight of 213.24 g/mol, XLogP of -0.38, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate is sourced from PubChem (CID 61322565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).