About cyclobutylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate
cyclobutylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate (PubChem CID 65459981) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is cyclobutylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate.
Analyze cyclobutylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate?
The IUPAC name of cyclobutylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate (CID 65459981) is cyclobutylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate.
What is the SMILES notation for cyclobutylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate?
The canonical SMILES for cyclobutylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate is Cc1nn(CC(=O)OCC2CCC2)c(C)c1N.
What is the InChIKey of cyclobutylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate?
The InChIKey is WBQVSXRAOPIVHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c1-8-12(13)9(2)15(14-8)6-11(16)17-7-10-4-3-5-10/h10H,3-7,13H2,1-2H3.
What are the key properties of cyclobutylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate?
cyclobutylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate has a molecular weight of 237.30 g/mol, XLogP of 1.43, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutylmethyl 2-(4-amino-3,5-dimethylpyrazol-1-yl)acetate is sourced from PubChem (CID 65459981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).