C8H16ClN3 — CID 50944289
3,5-dimethyl-1-propylpyrazol-4-amine;hydrochloride (PubChem CID 50944289) has the molecular formula C8H16ClN3 and a molecular weight of 189.69 g/mol. Its IUPAC name is 3,5-dimethyl-1-propylpyrazol-4-amine;hydrochloride.
| Compound Name | 3,5-dimethyl-1-propylpyrazol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 50944289 |
| Molecular Formula | C8H16ClN3 |
| Molecular Weight | 189.69 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 3,5-dimethyl-1-propylpyrazol-4-amine;hydrochloride |
| SMILES | CCCn1nc(C)c(N)c1C.Cl |
| InChI | InChI=1S/C8H15N3.ClH/c1-4-5-11-7(3)8(9)6(2)10-11;/h4-5,9H2,1-3H3;1H |
| InChIKey | BYCYZENIRLSGAB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.69 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |