C10H17N3 — CID 165471853
3,5-dimethyl-1-pent-4-enylpyrazol-4-amine (PubChem CID 165471853) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 3,5-dimethyl-1-pent-4-enylpyrazol-4-amine.
| Compound Name | 3,5-dimethyl-1-pent-4-enylpyrazol-4-amine |
|---|---|
| PubChem CID | 165471853 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 3,5-dimethyl-1-pent-4-enylpyrazol-4-amine |
| SMILES | C=CCCCn1nc(C)c(N)c1C |
| InChI | InChI=1S/C10H17N3/c1-4-5-6-7-13-9(3)10(11)8(2)12-13/h4H,1,5-7,11H2,2-3H3 |
| InChIKey | AFIBHLSTMCOPKL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|