C8H15N3 — CID 3031275
3,5-dimethyl-1-propan-2-ylpyrazol-4-amine (PubChem CID 3031275) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 3,5-dimethyl-1-propan-2-ylpyrazol-4-amine.
| Compound Name | 3,5-dimethyl-1-propan-2-ylpyrazol-4-amine |
|---|---|
| PubChem CID | 3031275 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 3,5-dimethyl-1-propan-2-ylpyrazol-4-amine |
| SMILES | Cc1nn(C(C)C)c(C)c1N |
| InChI | InChI=1S/C8H15N3/c1-5(2)11-7(4)8(9)6(3)10-11/h5H,9H2,1-4H3 |
| InChIKey | YWDXPQXEGATNSX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |