C8H15N3 — CID 6492580
2-(3,4,5-trimethylpyrazol-1-yl)ethanamine (PubChem CID 6492580) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 2-(3,4,5-trimethylpyrazol-1-yl)ethanamine.
| Compound Name | 2-(3,4,5-trimethylpyrazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 6492580 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 2-(3,4,5-trimethylpyrazol-1-yl)ethanamine |
| SMILES | Cc1nn(CCN)c(C)c1C |
| InChI | InChI=1S/C8H15N3/c1-6-7(2)10-11(5-4-9)8(6)3/h4-5,9H2,1-3H3 |
| InChIKey | LZVMGQKKGYOOEM-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |