About 2-(1-butyl-3,5-dimethylpyrazol-4-yl)sulfanylethanamine
2-(1-butyl-3,5-dimethylpyrazol-4-yl)sulfanylethanamine (PubChem CID 112707195) has the molecular formula C11H21N3S
and a molecular weight of 227.38 g/mol. Its IUPAC name is 2-(1-butyl-3,5-dimethylpyrazol-4-yl)sulfanylethanamine.
Molecular Properties
| Compound Name | 2-(1-butyl-3,5-dimethylpyrazol-4-yl)sulfanylethanamine |
| PubChem CID | 112707195 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-(1-butyl-3,5-dimethylpyrazol-4-yl)sulfanylethanamine |
| SMILES | CCCCn1nc(C)c(SCCN)c1C |
| InChI | InChI=1S/C11H21N3S/c1-4-5-7-14-10(3)11(9(2)13-14)15-8-6-12/h4-8,12H2,1-3H3 |
| InChIKey | WCUMZODAACGMBA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-butyl-3,5-dimethylpyrazol-4-yl)sulfanylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-butyl-3,5-dimethylpyrazol-4-yl)sulfanylethanamine?
The IUPAC name of 2-(1-butyl-3,5-dimethylpyrazol-4-yl)sulfanylethanamine (CID 112707195) is 2-(1-butyl-3,5-dimethylpyrazol-4-yl)sulfanylethanamine.
What is the SMILES notation for 2-(1-butyl-3,5-dimethylpyrazol-4-yl)sulfanylethanamine?
The canonical SMILES for 2-(1-butyl-3,5-dimethylpyrazol-4-yl)sulfanylethanamine is CCCCn1nc(C)c(SCCN)c1C.
What is the InChIKey of 2-(1-butyl-3,5-dimethylpyrazol-4-yl)sulfanylethanamine?
The InChIKey is WCUMZODAACGMBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3S/c1-4-5-7-14-10(3)11(9(2)13-14)15-8-6-12/h4-8,12H2,1-3H3.
What are the key properties of 2-(1-butyl-3,5-dimethylpyrazol-4-yl)sulfanylethanamine?
2-(1-butyl-3,5-dimethylpyrazol-4-yl)sulfanylethanamine has a molecular weight of 227.38 g/mol, XLogP of 2.35, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-butyl-3,5-dimethylpyrazol-4-yl)sulfanylethanamine is sourced from PubChem (CID 112707195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).