About 4-bromo-1-decyl-3,5-dimethylpyrazole
4-bromo-1-decyl-3,5-dimethylpyrazole (PubChem CID 63428341) has the molecular formula C15H27BrN2
and a molecular weight of 315.30 g/mol. Its IUPAC name is 4-bromo-1-decyl-3,5-dimethylpyrazole.
Molecular Properties
| Compound Name | 4-bromo-1-decyl-3,5-dimethylpyrazole |
| PubChem CID | 63428341 |
| Molecular Formula | C15H27BrN2 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 4-bromo-1-decyl-3,5-dimethylpyrazole |
| SMILES | CCCCCCCCCCn1nc(C)c(Br)c1C |
| InChI | InChI=1S/C15H27BrN2/c1-4-5-6-7-8-9-10-11-12-18-14(3)15(16)13(2)17-18/h4-12H2,1-3H3 |
| InChIKey | JZBDDMXRLXLSTH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1-decyl-3,5-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-decyl-3,5-dimethylpyrazole?
The IUPAC name of 4-bromo-1-decyl-3,5-dimethylpyrazole (CID 63428341) is 4-bromo-1-decyl-3,5-dimethylpyrazole.
What is the SMILES notation for 4-bromo-1-decyl-3,5-dimethylpyrazole?
The canonical SMILES for 4-bromo-1-decyl-3,5-dimethylpyrazole is CCCCCCCCCCn1nc(C)c(Br)c1C.
What is the InChIKey of 4-bromo-1-decyl-3,5-dimethylpyrazole?
The InChIKey is JZBDDMXRLXLSTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27BrN2/c1-4-5-6-7-8-9-10-11-12-18-14(3)15(16)13(2)17-18/h4-12H2,1-3H3.
What are the key properties of 4-bromo-1-decyl-3,5-dimethylpyrazole?
4-bromo-1-decyl-3,5-dimethylpyrazole has a molecular weight of 315.30 g/mol, XLogP of 5.40, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-decyl-3,5-dimethylpyrazole is sourced from PubChem (CID 63428341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).