C10H17BrN2S — CID 115651017
4-bromo-1-(3-ethylsulfanylpropyl)-3,5-dimethylpyrazole (PubChem CID 115651017) has the molecular formula C10H17BrN2S and a molecular weight of 277.23 g/mol. Its IUPAC name is 4-bromo-1-(3-ethylsulfanylpropyl)-3,5-dimethylpyrazole.
| Compound Name | 4-bromo-1-(3-ethylsulfanylpropyl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 115651017 |
| Molecular Formula | C10H17BrN2S |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 4-bromo-1-(3-ethylsulfanylpropyl)-3,5-dimethylpyrazole |
| SMILES | CCSCCCn1nc(C)c(Br)c1C |
| InChI | InChI=1S/C10H17BrN2S/c1-4-14-7-5-6-13-9(3)10(11)8(2)12-13/h4-7H2,1-3H3 |
| InChIKey | XXYYEWPMEJMEAJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|