About N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]butan-2-amine
N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]butan-2-amine (PubChem CID 62565845) has the molecular formula C11H20BrN3
and a molecular weight of 274.21 g/mol. Its IUPAC name is N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]butan-2-amine.
Molecular Properties
| Compound Name | N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]butan-2-amine |
| PubChem CID | 62565845 |
| Molecular Formula | C11H20BrN3 |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]butan-2-amine |
| SMILES | CCC(C)NCCn1nc(C)c(Br)c1C |
| InChI | InChI=1S/C11H20BrN3/c1-5-8(2)13-6-7-15-10(4)11(12)9(3)14-15/h8,13H,5-7H2,1-4H3 |
| InChIKey | GYBJYXNUXADRSB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]butan-2-amine?
The IUPAC name of N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]butan-2-amine (CID 62565845) is N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]butan-2-amine.
What is the SMILES notation for N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]butan-2-amine?
The canonical SMILES for N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]butan-2-amine is CCC(C)NCCn1nc(C)c(Br)c1C.
What is the InChIKey of N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]butan-2-amine?
The InChIKey is GYBJYXNUXADRSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20BrN3/c1-5-8(2)13-6-7-15-10(4)11(12)9(3)14-15/h8,13H,5-7H2,1-4H3.
What are the key properties of N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]butan-2-amine?
N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]butan-2-amine has a molecular weight of 274.21 g/mol, XLogP of 2.65, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethyl]butan-2-amine is sourced from PubChem (CID 62565845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).