About 4-bromo-3,5-dimethyl-1-(2-methylsulfanylethyl)pyrazole
4-bromo-3,5-dimethyl-1-(2-methylsulfanylethyl)pyrazole (PubChem CID 115773469) has the molecular formula C8H13BrN2S
and a molecular weight of 249.18 g/mol. Its IUPAC name is 4-bromo-3,5-dimethyl-1-(2-methylsulfanylethyl)pyrazole.
Analyze 4-bromo-3,5-dimethyl-1-(2-methylsulfanylethyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3,5-dimethyl-1-(2-methylsulfanylethyl)pyrazole?
The IUPAC name of 4-bromo-3,5-dimethyl-1-(2-methylsulfanylethyl)pyrazole (CID 115773469) is 4-bromo-3,5-dimethyl-1-(2-methylsulfanylethyl)pyrazole.
What is the SMILES notation for 4-bromo-3,5-dimethyl-1-(2-methylsulfanylethyl)pyrazole?
The canonical SMILES for 4-bromo-3,5-dimethyl-1-(2-methylsulfanylethyl)pyrazole is CSCCn1nc(C)c(Br)c1C.
What is the InChIKey of 4-bromo-3,5-dimethyl-1-(2-methylsulfanylethyl)pyrazole?
The InChIKey is WXQFODXJRVRMCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13BrN2S/c1-6-8(9)7(2)11(10-6)4-5-12-3/h4-5H2,1-3H3.
What are the key properties of 4-bromo-3,5-dimethyl-1-(2-methylsulfanylethyl)pyrazole?
4-bromo-3,5-dimethyl-1-(2-methylsulfanylethyl)pyrazole has a molecular weight of 249.18 g/mol, XLogP of 2.63, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3,5-dimethyl-1-(2-methylsulfanylethyl)pyrazole is sourced from PubChem (CID 115773469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).