C13H25N3 — CID 62729687
2-(1-hexyl-3,5-dimethylpyrazol-4-yl)ethanamine (PubChem CID 62729687) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 2-(1-hexyl-3,5-dimethylpyrazol-4-yl)ethanamine.
| Compound Name | 2-(1-hexyl-3,5-dimethylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 62729687 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 2-(1-hexyl-3,5-dimethylpyrazol-4-yl)ethanamine |
| SMILES | CCCCCCn1nc(C)c(CCN)c1C |
| InChI | InChI=1S/C13H25N3/c1-4-5-6-7-10-16-12(3)13(8-9-14)11(2)15-16/h4-10,14H2,1-3H3 |
| InChIKey | BCZDQAIPDYHZSN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|