C12H22N2O — CID 62229176
5-(4-ethyl-3,5-dimethylpyrazol-1-yl)pentan-1-ol (PubChem CID 62229176) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 5-(4-ethyl-3,5-dimethylpyrazol-1-yl)pentan-1-ol.
| Compound Name | 5-(4-ethyl-3,5-dimethylpyrazol-1-yl)pentan-1-ol |
|---|---|
| PubChem CID | 62229176 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 5-(4-ethyl-3,5-dimethylpyrazol-1-yl)pentan-1-ol |
| SMILES | CCc1c(C)nn(CCCCCO)c1C |
| InChI | InChI=1S/C12H22N2O/c1-4-12-10(2)13-14(11(12)3)8-6-5-7-9-15/h15H,4-9H2,1-3H3 |
| InChIKey | KEGLZKDHONPVQN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|