C11H21N3O — CID 64811343
2-amino-4-(4-ethyl-3,5-dimethylpyrazol-1-yl)butan-1-ol (PubChem CID 64811343) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 2-amino-4-(4-ethyl-3,5-dimethylpyrazol-1-yl)butan-1-ol.
| Compound Name | 2-amino-4-(4-ethyl-3,5-dimethylpyrazol-1-yl)butan-1-ol |
|---|---|
| PubChem CID | 64811343 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 2-amino-4-(4-ethyl-3,5-dimethylpyrazol-1-yl)butan-1-ol |
| SMILES | CCc1c(C)nn(CCC(N)CO)c1C |
| InChI | InChI=1S/C11H21N3O/c1-4-11-8(2)13-14(9(11)3)6-5-10(12)7-15/h10,15H,4-7,12H2,1-3H3 |
| InChIKey | WLZPOMXGNMFNKL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |