C15H28N4O — CID 106711709
6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide (PubChem CID 106711709) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is 6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide.
| Compound Name | 6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106711709 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 6-(4-ethyl-3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,2-dimethylhexanimidamide |
| SMILES | CCc1c(C)nn(CCCCC(C)(C)C(N)=NO)c1C |
| InChI | InChI=1S/C15H28N4O/c1-6-13-11(2)17-19(12(13)3)10-8-7-9-15(4,5)14(16)18-20/h20H,6-10H2,1-5H3,(H2,16,18) |
| InChIKey | GQVCDZCWCDQFFR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|