C21H26N6O — CID 6283922
N-[(Z)-(3,5-dimethyl-1-pentylpyrazol-4-yl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 6283922) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is N-[(Z)-(3,5-dimethyl-1-pentylpyrazol-4-yl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(Z)-(3,5-dimethyl-1-pentylpyrazol-4-yl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6283922 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | N-[(Z)-(3,5-dimethyl-1-pentylpyrazol-4-yl)methylideneamino]-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | CCCCCn1nc(C)c(/C=N\NC(=O)c2cc(-c3ccccc3)n[nH]2)c1C |
| InChI | InChI=1S/C21H26N6O/c1-4-5-9-12-27-16(3)18(15(2)26-27)14-22-25-21(28)20-13-19(23-24-20)17-10-7-6-8-11-17/h6-8,10-11,13-14H,4-5,9,12H2,1-3H3,(H,23,24)(H,25,28)/b22-14- |
| InChIKey | YYZXQQIEGCUVIR-HMAPJEAMSA-N |
| XLogP | 3.84 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|