C17H19ClN2O4 — CID 135789498
3-[(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]-4-hydroxy-6-methylpyran-2-one (PubChem CID 135789498) has the molecular formula C17H19ClN2O4 and a molecular weight of 350.80 g/mol. Its IUPAC name is 3-[(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]-4-hydroxy-6-methylpyran-2-one.
| Compound Name | 3-[(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]-4-hydroxy-6-methylpyran-2-one |
|---|---|
| PubChem CID | 135789498 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 3-[(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoyl]-4-hydroxy-6-methylpyran-2-one |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)c2c(O)cc(C)oc2=O)c1Cl |
| InChI | InChI=1S/C17H19ClN2O4/c1-4-5-8-20-16(18)12(11(3)19-20)6-7-13(21)15-14(22)9-10(2)24-17(15)23/h6-7,9,22H,4-5,8H2,1-3H3/b7-6+ |
| InChIKey | VOHGMOKFKWDOSQ-VOTSOKGWSA-N |
| XLogP | 3.51 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|