C14H20ClN3O3 — CID 7978780
[2-(methylamino)-2-oxoethyl] (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate (PubChem CID 7978780) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [2-(methylamino)-2-oxoethyl] (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7978780 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoate |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)OCC(=O)NC)c1Cl |
| InChI | InChI=1S/C14H20ClN3O3/c1-4-5-8-18-14(15)11(10(2)17-18)6-7-13(20)21-9-12(19)16-3/h6-7H,4-5,8-9H2,1-3H3,(H,16,19)/b7-6+ |
| InChIKey | OJOQIIOVFNSHCR-VOTSOKGWSA-N |
| XLogP | 1.95 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|