C20H33ClN4O3 — CID 72686470
tert-butyl N-[2-[3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoylamino]-2-methylpropyl]carbamate (PubChem CID 72686470) has the molecular formula C20H33ClN4O3 and a molecular weight of 412.96 g/mol. Its IUPAC name is tert-butyl N-[2-[3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoylamino]-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoylamino]-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 72686470 |
| Molecular Formula | C20H33ClN4O3 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | tert-butyl N-[2-[3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)prop-2-enoylamino]-2-methylpropyl]carbamate |
| SMILES | CCCCn1nc(C)c(C=CC(=O)NC(C)(C)CNC(=O)OC(C)(C)C)c1Cl |
| InChI | InChI=1S/C20H33ClN4O3/c1-8-9-12-25-17(21)15(14(2)24-25)10-11-16(26)23-20(6,7)13-22-18(27)28-19(3,4)5/h10-11H,8-9,12-13H2,1-7H3,(H,22,27)(H,23,26) |
| InChIKey | RKRIGGWMVDVCEB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|