About (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N,N-dipropylprop-2-enamide
(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N,N-dipropylprop-2-enamide (PubChem CID 52516894) has the molecular formula C17H28ClN3O
and a molecular weight of 325.88 g/mol. Its IUPAC name is (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N,N-dipropylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N,N-dipropylprop-2-enamide |
| PubChem CID | 52516894 |
| Molecular Formula | C17H28ClN3O |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N,N-dipropylprop-2-enamide |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)N(CCC)CCC)c1Cl |
| InChI | InChI=1S/C17H28ClN3O/c1-5-8-13-21-17(18)15(14(4)19-21)9-10-16(22)20(11-6-2)12-7-3/h9-10H,5-8,11-13H2,1-4H3/b10-9+ |
| InChIKey | GQYAAEFLHOAPSD-MDZDMXLPSA-N |
| XLogP | 4.31 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N,N-dipropylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N,N-dipropylprop-2-enamide?
The IUPAC name of (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N,N-dipropylprop-2-enamide (CID 52516894) is (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N,N-dipropylprop-2-enamide.
What is the SMILES notation for (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N,N-dipropylprop-2-enamide?
The canonical SMILES for (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N,N-dipropylprop-2-enamide is CCCCn1nc(C)c(/C=C/C(=O)N(CCC)CCC)c1Cl.
What is the InChIKey of (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N,N-dipropylprop-2-enamide?
The InChIKey is GQYAAEFLHOAPSD-MDZDMXLPSA-N. The full InChI is InChI=1S/C17H28ClN3O/c1-5-8-13-21-17(18)15(14(4)19-21)9-10-16(22)20(11-6-2)12-7-3/h9-10H,5-8,11-13H2,1-4H3/b10-9+.
What are the key properties of (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N,N-dipropylprop-2-enamide?
(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N,N-dipropylprop-2-enamide has a molecular weight of 325.88 g/mol, XLogP of 4.31, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N,N-dipropylprop-2-enamide is sourced from PubChem (CID 52516894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).