C20H25ClN4O2 — CID 55638702
(E)-N-(2-anilino-2-oxoethyl)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-methylprop-2-enamide (PubChem CID 55638702) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is (E)-N-(2-anilino-2-oxoethyl)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-(2-anilino-2-oxoethyl)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 55638702 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (E)-N-(2-anilino-2-oxoethyl)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-methylprop-2-enamide |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)N(C)CC(=O)Nc2ccccc2)c1Cl |
| InChI | InChI=1S/C20H25ClN4O2/c1-4-5-13-25-20(21)17(15(2)23-25)11-12-19(27)24(3)14-18(26)22-16-9-7-6-8-10-16/h6-12H,4-5,13-14H2,1-3H3,(H,22,26)/b12-11+ |
| InChIKey | WHZRAINMFCRGHP-VAWYXSNFSA-N |
| XLogP | 3.76 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|