C19H22ClF2N3O — CID 55549462
(E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[(2,4-difluorophenyl)methyl]-N-methylprop-2-enamide (PubChem CID 55549462) has the molecular formula C19H22ClF2N3O and a molecular weight of 381.85 g/mol. Its IUPAC name is (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[(2,4-difluorophenyl)methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[(2,4-difluorophenyl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 55549462 |
| Molecular Formula | C19H22ClF2N3O |
| Molecular Weight | 381.85 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (E)-3-(1-butyl-5-chloro-3-methylpyrazol-4-yl)-N-[(2,4-difluorophenyl)methyl]-N-methylprop-2-enamide |
| SMILES | CCCCn1nc(C)c(/C=C/C(=O)N(C)Cc2ccc(F)cc2F)c1Cl |
| InChI | InChI=1S/C19H22ClF2N3O/c1-4-5-10-25-19(20)16(13(2)23-25)8-9-18(26)24(3)12-14-6-7-15(21)11-17(14)22/h6-9,11H,4-5,10,12H2,1-3H3/b9-8+ |
| InChIKey | RJMXRZCJPUHABG-CMDGGOBGSA-N |
| XLogP | 4.60 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.85 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|