C15H11F3N2O2 — CID 59021950
3-[(E)-[[2-(trifluoromethyl)phenyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 59021950) has the molecular formula C15H11F3N2O2 and a molecular weight of 308.26 g/mol. Its IUPAC name is 3-[(E)-[[2-(trifluoromethyl)phenyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 3-[(E)-[[2-(trifluoromethyl)phenyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 59021950 |
| Molecular Formula | C15H11F3N2O2 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3-[(E)-[[2-(trifluoromethyl)phenyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(/C=N/Nc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11F3N2O2/c16-15(17,18)12-6-1-2-7-13(12)20-19-9-10-4-3-5-11(8-10)14(21)22/h1-9,20H,(H,21,22)/b19-9+ |
| InChIKey | SHOIULRCNGPDAD-DJKKODMXSA-N |
| XLogP | 3.85 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|