C14H6F8N2 — CID 134097959
2,3,4,5,6-pentafluoro-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]aniline (PubChem CID 134097959) has the molecular formula C14H6F8N2 and a molecular weight of 354.20 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 134097959 |
| Molecular Formula | C14H6F8N2 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]aniline |
| SMILES | Fc1c(F)c(F)c(N/N=C/c2ccc(C(F)(F)F)cc2)c(F)c1F |
| InChI | InChI=1S/C14H6F8N2/c15-8-9(16)11(18)13(12(19)10(8)17)24-23-5-6-1-3-7(4-2-6)14(20,21)22/h1-5,24H/b23-5+ |
| InChIKey | SYWDOGBVZRGLPB-MUDSWDHVSA-N |
| XLogP | 4.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|