C13H6F6N2 — CID 14933363
2,3,4,5,6-pentafluoro-N-[(E)-(4-fluorophenyl)methylideneamino]aniline (PubChem CID 14933363) has the molecular formula C13H6F6N2 and a molecular weight of 304.19 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(E)-(4-fluorophenyl)methylideneamino]aniline.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(E)-(4-fluorophenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 14933363 |
| Molecular Formula | C13H6F6N2 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(E)-(4-fluorophenyl)methylideneamino]aniline |
| SMILES | Fc1ccc(/C=N/Nc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C13H6F6N2/c14-7-3-1-6(2-4-7)5-20-21-13-11(18)9(16)8(15)10(17)12(13)19/h1-5,21H/b20-5+ |
| InChIKey | SXUMMIROJIGOKW-DENHBWNVSA-N |
| XLogP | 3.97 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|