C24H19ClF3N5O2S — CID 118590189
1-[1-(4-chlorophenyl)-2-hydroxyethyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea (PubChem CID 118590189) has the molecular formula C24H19ClF3N5O2S and a molecular weight of 533.96 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)-2-hydroxyethyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea.
| Compound Name | 1-[1-(4-chlorophenyl)-2-hydroxyethyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea |
|---|---|
| PubChem CID | 118590189 |
| Molecular Formula | C24H19ClF3N5O2S |
| Molecular Weight | 533.96 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | 1-[1-(4-chlorophenyl)-2-hydroxyethyl]-3-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]thiourea |
| SMILES | OCC(NC(=S)Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H19ClF3N5O2S/c25-17-5-1-15(2-6-17)21(13-34)31-23(36)30-18-7-3-16(4-8-18)22-29-14-33(32-22)19-9-11-20(12-10-19)35-24(26,27)28/h1-12,14,21,34H,13H2,(H2,30,31,36) |
| InChIKey | CPXLPOAAENCLJR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.96 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|