C25H24F3N7O3 — CID 171925641
2-[hydroxy-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]anilino]methyl]-1-(4-methoxy-2-methylphenyl)guanidine (PubChem CID 171925641) has the molecular formula C25H24F3N7O3 and a molecular weight of 527.51 g/mol. Its IUPAC name is 2-[hydroxy-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]anilino]methyl]-1-(4-methoxy-2-methylphenyl)guanidine.
| Compound Name | 2-[hydroxy-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]anilino]methyl]-1-(4-methoxy-2-methylphenyl)guanidine |
|---|---|
| PubChem CID | 171925641 |
| Molecular Formula | C25H24F3N7O3 |
| Molecular Weight | 527.51 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 2-[hydroxy-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]anilino]methyl]-1-(4-methoxy-2-methylphenyl)guanidine |
| SMILES | COc1ccc(NC(N)=NC(O)Nc2ccc(-c3ncn(-c4ccc(OC(F)(F)F)cc4)n3)cc2)c(C)c1 |
| InChI | InChI=1S/C25H24F3N7O3/c1-15-13-20(37-2)11-12-21(15)32-23(29)33-24(36)31-17-5-3-16(4-6-17)22-30-14-35(34-22)18-7-9-19(10-8-18)38-25(26,27)28/h3-14,24,31,36H,1-2H3,(H3,29,32,33) |
| InChIKey | GZEHWVQVALHMAZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|