C30H26F3N5O2 — CID 148794863
[2-(2-ethylphenyl)anilino]-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]anilino]methanol (PubChem CID 148794863) has the molecular formula C30H26F3N5O2 and a molecular weight of 545.57 g/mol. Its IUPAC name is [2-(2-ethylphenyl)anilino]-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]anilino]methanol.
| Compound Name | [2-(2-ethylphenyl)anilino]-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]anilino]methanol |
|---|---|
| PubChem CID | 148794863 |
| Molecular Formula | C30H26F3N5O2 |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | [2-(2-ethylphenyl)anilino]-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]anilino]methanol |
| SMILES | CCc1ccccc1-c1ccccc1NC(O)Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C30H26F3N5O2/c1-2-20-7-3-4-8-25(20)26-9-5-6-10-27(26)36-29(39)35-22-13-11-21(12-14-22)28-34-19-38(37-28)23-15-17-24(18-16-23)40-30(31,32)33/h3-19,29,35-36,39H,2H2,1H3 |
| InChIKey | OMXCVFUVMFNKRH-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|