C25H20F3N5O2S — CID 89391612
(Z)-3-(2-methylanilino)-3-sulfanyl-N-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]prop-2-enamide (PubChem CID 89391612) has the molecular formula C25H20F3N5O2S and a molecular weight of 511.53 g/mol. Its IUPAC name is (Z)-3-(2-methylanilino)-3-sulfanyl-N-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]prop-2-enamide.
| Compound Name | (Z)-3-(2-methylanilino)-3-sulfanyl-N-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 89391612 |
| Molecular Formula | C25H20F3N5O2S |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | (Z)-3-(2-methylanilino)-3-sulfanyl-N-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]prop-2-enamide |
| SMILES | Cc1ccccc1N/C(S)=C/C(=O)Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C25H20F3N5O2S/c1-16-4-2-3-5-21(16)31-23(36)14-22(34)30-18-8-6-17(7-9-18)24-29-15-33(32-24)19-10-12-20(13-11-19)35-25(26,27)28/h2-15,31,36H,1H3,(H,30,34)/b23-14- |
| InChIKey | XTJLQXSYKQJJHE-UCQKPKSFSA-N |
| XLogP | 5.96 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|