C29H24F3N7O2 — CID 171923835
2-[hydroxy-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]anilino]methyl]-1-(2-phenylphenyl)guanidine (PubChem CID 171923835) has the molecular formula C29H24F3N7O2 and a molecular weight of 559.55 g/mol. Its IUPAC name is 2-[hydroxy-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]anilino]methyl]-1-(2-phenylphenyl)guanidine.
| Compound Name | 2-[hydroxy-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]anilino]methyl]-1-(2-phenylphenyl)guanidine |
|---|---|
| PubChem CID | 171923835 |
| Molecular Formula | C29H24F3N7O2 |
| Molecular Weight | 559.55 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 2-[hydroxy-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]anilino]methyl]-1-(2-phenylphenyl)guanidine |
| SMILES | NC(=NC(O)Nc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C29H24F3N7O2/c30-29(31,32)41-23-16-14-22(15-17-23)39-18-34-26(38-39)20-10-12-21(13-11-20)35-28(40)37-27(33)36-25-9-5-4-8-24(25)19-6-2-1-3-7-19/h1-18,28,35,40H,(H3,33,36,37) |
| InChIKey | LALDPLJROWCGAF-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.55 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|