C27H28F3N5O2S — CID 159226599
(4-methoxy-2-methylphenyl)thiourea;3-(4-propylphenyl)-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazole (PubChem CID 159226599) has the molecular formula C27H28F3N5O2S and a molecular weight of 543.62 g/mol. Its IUPAC name is (4-methoxy-2-methylphenyl)thiourea;3-(4-propylphenyl)-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazole.
| Compound Name | (4-methoxy-2-methylphenyl)thiourea;3-(4-propylphenyl)-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 159226599 |
| Molecular Formula | C27H28F3N5O2S |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | (4-methoxy-2-methylphenyl)thiourea;3-(4-propylphenyl)-1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazole |
| SMILES | CCCc1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1.COc1ccc(NC(N)=S)c(C)c1 |
| InChI | InChI=1S/C18H16F3N3O.C9H12N2OS/c1-2-3-13-4-6-14(7-5-13)17-22-12-24(23-17)15-8-10-16(11-9-15)25-18(19,20)21;1-6-5-7(12-2)3-4-8(6)11-9(10)13/h4-12H,2-3H2,1H3;3-5H,1-2H3,(H3,10,11,13) |
| InChIKey | KSJCMQNWVKNERK-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|