C15H14F3N3O2 — CID 135122736
N-methyl-6-prop-2-enoxy-N-[4-(trifluoromethoxy)phenyl]pyridazin-3-amine (PubChem CID 135122736) has the molecular formula C15H14F3N3O2 and a molecular weight of 325.29 g/mol. Its IUPAC name is N-methyl-6-prop-2-enoxy-N-[4-(trifluoromethoxy)phenyl]pyridazin-3-amine.
| Compound Name | N-methyl-6-prop-2-enoxy-N-[4-(trifluoromethoxy)phenyl]pyridazin-3-amine |
|---|---|
| PubChem CID | 135122736 |
| Molecular Formula | C15H14F3N3O2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-methyl-6-prop-2-enoxy-N-[4-(trifluoromethoxy)phenyl]pyridazin-3-amine |
| SMILES | C=CCOc1ccc(N(C)c2ccc(OC(F)(F)F)cc2)nn1 |
| InChI | InChI=1S/C15H14F3N3O2/c1-3-10-22-14-9-8-13(19-20-14)21(2)11-4-6-12(7-5-11)23-15(16,17)18/h3-9H,1,10H2,2H3 |
| InChIKey | PHZXGXQIJAKFDP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|