C14H11F3N4O — CID 133433734
6-[methyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]pyridazine-3-carbonitrile (PubChem CID 133433734) has the molecular formula C14H11F3N4O and a molecular weight of 308.26 g/mol. Its IUPAC name is 6-[methyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]pyridazine-3-carbonitrile.
| Compound Name | 6-[methyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 133433734 |
| Molecular Formula | C14H11F3N4O |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 6-[methyl-[[4-(trifluoromethoxy)phenyl]methyl]amino]pyridazine-3-carbonitrile |
| SMILES | CN(Cc1ccc(OC(F)(F)F)cc1)c1ccc(C#N)nn1 |
| InChI | InChI=1S/C14H11F3N4O/c1-21(13-7-4-11(8-18)19-20-13)9-10-2-5-12(6-3-10)22-14(15,16)17/h2-7H,9H2,1H3 |
| InChIKey | SLQJAVRADRGBSD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 62.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |