C24H22F3N5O3S — CID 162603854
4-cyano-N-[(E)-1,2-diamino-2-[4-[[N-methyl-4-(trifluoromethoxy)anilino]methyl]phenyl]ethenyl]benzenesulfonamide (PubChem CID 162603854) has the molecular formula C24H22F3N5O3S and a molecular weight of 517.53 g/mol. Its IUPAC name is 4-cyano-N-[(E)-1,2-diamino-2-[4-[[N-methyl-4-(trifluoromethoxy)anilino]methyl]phenyl]ethenyl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[(E)-1,2-diamino-2-[4-[[N-methyl-4-(trifluoromethoxy)anilino]methyl]phenyl]ethenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 162603854 |
| Molecular Formula | C24H22F3N5O3S |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 4-cyano-N-[(E)-1,2-diamino-2-[4-[[N-methyl-4-(trifluoromethoxy)anilino]methyl]phenyl]ethenyl]benzenesulfonamide |
| SMILES | CN(Cc1ccc(/C(N)=C(/N)NS(=O)(=O)c2ccc(C#N)cc2)cc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C24H22F3N5O3S/c1-32(19-8-10-20(11-9-19)35-24(25,26)27)15-17-2-6-18(7-3-17)22(29)23(30)31-36(33,34)21-12-4-16(14-28)5-13-21/h2-13,31H,15,29-30H2,1H3/b23-22+ |
| InChIKey | JCRDJNFLYGWXDY-GHVJWSGMSA-N |
| XLogP | 3.62 |
| TPSA | 134.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|