C26H21F3N5OS+ — CID 147031547
4-[[3-[4-[[N-methyl-4-(trifluoromethoxy)anilino]methyl]phenyl]pyrazin-1-ium-2-yl]amino]sulfanylbenzonitrile (PubChem CID 147031547) has the molecular formula C26H21F3N5OS+ and a molecular weight of 508.55 g/mol. Its IUPAC name is 4-[[3-[4-[[N-methyl-4-(trifluoromethoxy)anilino]methyl]phenyl]pyrazin-1-ium-2-yl]amino]sulfanylbenzonitrile.
| Compound Name | 4-[[3-[4-[[N-methyl-4-(trifluoromethoxy)anilino]methyl]phenyl]pyrazin-1-ium-2-yl]amino]sulfanylbenzonitrile |
|---|---|
| PubChem CID | 147031547 |
| Molecular Formula | C26H21F3N5OS+ |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 4-[[3-[4-[[N-methyl-4-(trifluoromethoxy)anilino]methyl]phenyl]pyrazin-1-ium-2-yl]amino]sulfanylbenzonitrile |
| SMILES | CN(Cc1ccc(-c2ncc[nH+]c2NSc2ccc(C#N)cc2)cc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H20F3N5OS/c1-34(21-8-10-22(11-9-21)35-26(27,28)29)17-19-2-6-20(7-3-19)24-25(32-15-14-31-24)33-36-23-12-4-18(16-30)5-13-23/h2-15H,17H2,1H3,(H,32,33)/p+1 |
| InChIKey | AXRVEBFJNHSMOS-UHFFFAOYSA-O |
| XLogP | 6.09 |
| TPSA | 75.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|