C26H23F3N4OS — CID 143309707
N-(4-methylphenyl)sulfanyl-3-[4-[[N-methyl-4-(trifluoromethoxy)anilino]methyl]phenyl]pyrazin-2-amine (PubChem CID 143309707) has the molecular formula C26H23F3N4OS and a molecular weight of 496.56 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfanyl-3-[4-[[N-methyl-4-(trifluoromethoxy)anilino]methyl]phenyl]pyrazin-2-amine.
| Compound Name | N-(4-methylphenyl)sulfanyl-3-[4-[[N-methyl-4-(trifluoromethoxy)anilino]methyl]phenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 143309707 |
| Molecular Formula | C26H23F3N4OS |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | N-(4-methylphenyl)sulfanyl-3-[4-[[N-methyl-4-(trifluoromethoxy)anilino]methyl]phenyl]pyrazin-2-amine |
| SMILES | Cc1ccc(SNc2nccnc2-c2ccc(CN(C)c3ccc(OC(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H23F3N4OS/c1-18-3-13-23(14-4-18)35-32-25-24(30-15-16-31-25)20-7-5-19(6-8-20)17-33(2)21-9-11-22(12-10-21)34-26(27,28)29/h3-16H,17H2,1-2H3,(H,31,32) |
| InChIKey | RUXQOHPSBICUPL-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|