C20H14F6N4O4 — CID 155250510
(2,2,2-trifluoroacetyl) 5-[[N-methyl-4-[4-(trifluoromethoxy)phenyl]anilino]methyl]-2H-triazole-4-carboxylate (PubChem CID 155250510) has the molecular formula C20H14F6N4O4 and a molecular weight of 488.34 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 5-[[N-methyl-4-[4-(trifluoromethoxy)phenyl]anilino]methyl]-2H-triazole-4-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 5-[[N-methyl-4-[4-(trifluoromethoxy)phenyl]anilino]methyl]-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 155250510 |
| Molecular Formula | C20H14F6N4O4 |
| Molecular Weight | 488.34 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 5-[[N-methyl-4-[4-(trifluoromethoxy)phenyl]anilino]methyl]-2H-triazole-4-carboxylate |
| SMILES | CN(Cc1n[nH]nc1C(=O)OC(=O)C(F)(F)F)c1ccc(-c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H14F6N4O4/c1-30(10-15-16(28-29-27-15)17(31)33-18(32)19(21,22)23)13-6-2-11(3-7-13)12-4-8-14(9-5-12)34-20(24,25)26/h2-9H,10H2,1H3,(H,27,28,29) |
| InChIKey | XOTLHAAXTUTJQH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|