C22H19F3N4O3S — CID 155250297
(2,2,2-trifluoroacetyl) 5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyl-2H-triazole-4-carboxylate (PubChem CID 155250297) has the molecular formula C22H19F3N4O3S and a molecular weight of 476.48 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyl-2H-triazole-4-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyl-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 155250297 |
| Molecular Formula | C22H19F3N4O3S |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyl-2H-triazole-4-carboxylate |
| SMILES | O=C(OC(=O)C(F)(F)F)c1n[nH]nc1Sc1ccc(-c2ccc(N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C22H19F3N4O3S/c23-22(24,25)21(31)32-20(30)18-19(27-28-26-18)33-17-10-6-15(7-11-17)14-4-8-16(9-5-14)29-12-2-1-3-13-29/h4-11H,1-3,12-13H2,(H,26,27,28) |
| InChIKey | LFGSYOSQCMSLGO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|