About 2-methylpropanoyl 3-methyl-5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyltriazole-4-carboperoxoate
2-methylpropanoyl 3-methyl-5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyltriazole-4-carboperoxoate (PubChem CID 175062176) has the molecular formula C25H28N4O4S
and a molecular weight of 480.59 g/mol. Its IUPAC name is 2-methylpropanoyl 3-methyl-5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyltriazole-4-carboperoxoate.
Molecular Properties
| Compound Name | 2-methylpropanoyl 3-methyl-5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyltriazole-4-carboperoxoate |
| PubChem CID | 175062176 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 2-methylpropanoyl 3-methyl-5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyltriazole-4-carboperoxoate |
| SMILES | CC(C)C(=O)OOC(=O)c1c(Sc2ccc(-c3ccc(N4CCCCC4)cc3)cc2)nnn1C |
| InChI | InChI=1S/C25H28N4O4S/c1-17(2)24(30)32-33-25(31)22-23(26-27-28(22)3)34-21-13-9-19(10-14-21)18-7-11-20(12-8-18)29-15-5-4-6-16-29/h7-14,17H,4-6,15-16H2,1-3H3 |
| InChIKey | SSSGEDXQXBXXRU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanoyl 3-methyl-5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyltriazole-4-carboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanoyl 3-methyl-5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyltriazole-4-carboperoxoate?
The IUPAC name of 2-methylpropanoyl 3-methyl-5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyltriazole-4-carboperoxoate (CID 175062176) is 2-methylpropanoyl 3-methyl-5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyltriazole-4-carboperoxoate.
What is the SMILES notation for 2-methylpropanoyl 3-methyl-5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyltriazole-4-carboperoxoate?
The canonical SMILES for 2-methylpropanoyl 3-methyl-5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyltriazole-4-carboperoxoate is CC(C)C(=O)OOC(=O)c1c(Sc2ccc(-c3ccc(N4CCCCC4)cc3)cc2)nnn1C.
What is the InChIKey of 2-methylpropanoyl 3-methyl-5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyltriazole-4-carboperoxoate?
The InChIKey is SSSGEDXQXBXXRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N4O4S/c1-17(2)24(30)32-33-25(31)22-23(26-27-28(22)3)34-21-13-9-19(10-14-21)18-7-11-20(12-8-18)29-15-5-4-6-16-29/h7-14,17H,4-6,15-16H2,1-3H3.
What are the key properties of 2-methylpropanoyl 3-methyl-5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyltriazole-4-carboperoxoate?
2-methylpropanoyl 3-methyl-5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyltriazole-4-carboperoxoate has a molecular weight of 480.59 g/mol, XLogP of 4.89, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanoyl 3-methyl-5-[4-(4-piperidin-1-ylphenyl)phenyl]sulfanyltriazole-4-carboperoxoate is sourced from PubChem (CID 175062176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).