C21H17F3N4O2S2 — CID 155027698
2-[4-cyano-N-[[4-(trifluoromethoxy)phenyl]methyl]anilino]-5-methyl-N-methylsulfanyl-1,3-thiazole-4-carboxamide (PubChem CID 155027698) has the molecular formula C21H17F3N4O2S2 and a molecular weight of 478.52 g/mol. Its IUPAC name is 2-[4-cyano-N-[[4-(trifluoromethoxy)phenyl]methyl]anilino]-5-methyl-N-methylsulfanyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[4-cyano-N-[[4-(trifluoromethoxy)phenyl]methyl]anilino]-5-methyl-N-methylsulfanyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 155027698 |
| Molecular Formula | C21H17F3N4O2S2 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 2-[4-cyano-N-[[4-(trifluoromethoxy)phenyl]methyl]anilino]-5-methyl-N-methylsulfanyl-1,3-thiazole-4-carboxamide |
| SMILES | CSNC(=O)c1nc(N(Cc2ccc(OC(F)(F)F)cc2)c2ccc(C#N)cc2)sc1C |
| InChI | InChI=1S/C21H17F3N4O2S2/c1-13-18(19(29)27-31-2)26-20(32-13)28(16-7-3-14(11-25)4-8-16)12-15-5-9-17(10-6-15)30-21(22,23)24/h3-10H,12H2,1-2H3,(H,27,29) |
| InChIKey | PWTVNUXSGJDWKV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|