C20H19F2N3O2S2 — CID 155027694
2-[N-benzyl-4-(difluoromethoxy)anilino]-5-methyl-N-methylsulfanyl-1,3-thiazole-4-carboxamide (PubChem CID 155027694) has the molecular formula C20H19F2N3O2S2 and a molecular weight of 435.52 g/mol. Its IUPAC name is 2-[N-benzyl-4-(difluoromethoxy)anilino]-5-methyl-N-methylsulfanyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[N-benzyl-4-(difluoromethoxy)anilino]-5-methyl-N-methylsulfanyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 155027694 |
| Molecular Formula | C20H19F2N3O2S2 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 2-[N-benzyl-4-(difluoromethoxy)anilino]-5-methyl-N-methylsulfanyl-1,3-thiazole-4-carboxamide |
| SMILES | CSNC(=O)c1nc(N(Cc2ccccc2)c2ccc(OC(F)F)cc2)sc1C |
| InChI | InChI=1S/C20H19F2N3O2S2/c1-13-17(18(26)24-28-2)23-20(29-13)25(12-14-6-4-3-5-7-14)15-8-10-16(11-9-15)27-19(21)22/h3-11,19H,12H2,1-2H3,(H,24,26) |
| InChIKey | RUYXXQDDIABEEI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|