C19H18ClN3OS2 — CID 155027673
2-(N-benzyl-2-chloroanilino)-5-methyl-N-methylsulfanyl-1,3-thiazole-4-carboxamide (PubChem CID 155027673) has the molecular formula C19H18ClN3OS2 and a molecular weight of 403.96 g/mol. Its IUPAC name is 2-(N-benzyl-2-chloroanilino)-5-methyl-N-methylsulfanyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(N-benzyl-2-chloroanilino)-5-methyl-N-methylsulfanyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 155027673 |
| Molecular Formula | C19H18ClN3OS2 |
| Molecular Weight | 403.96 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 2-(N-benzyl-2-chloroanilino)-5-methyl-N-methylsulfanyl-1,3-thiazole-4-carboxamide |
| SMILES | CSNC(=O)c1nc(N(Cc2ccccc2)c2ccccc2Cl)sc1C |
| InChI | InChI=1S/C19H18ClN3OS2/c1-13-17(18(24)22-25-2)21-19(26-13)23(12-14-8-4-3-5-9-14)16-11-7-6-10-15(16)20/h3-11H,12H2,1-2H3,(H,22,24) |
| InChIKey | WZINRHDOIDFPSJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.96 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|