C20H20N3O4S2- — CID 155028072
2-[N-benzyl-3-(2-hydroxyethyl)anilino]-5-methyl-4-(sulfinatocarbamoyl)-1,3-thiazole (PubChem CID 155028072) has the molecular formula C20H20N3O4S2- and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-[N-benzyl-3-(2-hydroxyethyl)anilino]-5-methyl-4-(sulfinatocarbamoyl)-1,3-thiazole.
| Compound Name | 2-[N-benzyl-3-(2-hydroxyethyl)anilino]-5-methyl-4-(sulfinatocarbamoyl)-1,3-thiazole |
|---|---|
| PubChem CID | 155028072 |
| Molecular Formula | C20H20N3O4S2- |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2-[N-benzyl-3-(2-hydroxyethyl)anilino]-5-methyl-4-(sulfinatocarbamoyl)-1,3-thiazole |
| SMILES | Cc1sc(N(Cc2ccccc2)c2cccc(CCO)c2)nc1C(=O)NS(=O)[O-] |
| InChI | InChI=1S/C20H21N3O4S2/c1-14-18(19(25)22-29(26)27)21-20(28-14)23(13-16-6-3-2-4-7-16)17-9-5-8-15(12-17)10-11-24/h2-9,12,24H,10-11,13H2,1H3,(H,22,25)(H,26,27)/p-1 |
| InChIKey | DAKWPTGEPASHBA-UHFFFAOYSA-M |
| XLogP | 2.85 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|