C26H21ClN4OS2 — CID 155027928
2-(N-benzyl-4-cyanoanilino)-N-[(3-chlorophenyl)methylsulfanyl]-5-methyl-1,3-thiazole-4-carboxamide (PubChem CID 155027928) has the molecular formula C26H21ClN4OS2 and a molecular weight of 505.07 g/mol. Its IUPAC name is 2-(N-benzyl-4-cyanoanilino)-N-[(3-chlorophenyl)methylsulfanyl]-5-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(N-benzyl-4-cyanoanilino)-N-[(3-chlorophenyl)methylsulfanyl]-5-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 155027928 |
| Molecular Formula | C26H21ClN4OS2 |
| Molecular Weight | 505.07 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 2-(N-benzyl-4-cyanoanilino)-N-[(3-chlorophenyl)methylsulfanyl]-5-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1sc(N(Cc2ccccc2)c2ccc(C#N)cc2)nc1C(=O)NSCc1cccc(Cl)c1 |
| InChI | InChI=1S/C26H21ClN4OS2/c1-18-24(25(32)30-33-17-21-8-5-9-22(27)14-21)29-26(34-18)31(16-20-6-3-2-4-7-20)23-12-10-19(15-28)11-13-23/h2-14H,16-17H2,1H3,(H,30,32) |
| InChIKey | GPYZCMPWJCITTH-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.07 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|