C20H15F3N4OS2 — CID 145326794
2-[4-cyano-N-[(2,3,5-trifluorophenyl)methyl]anilino]-5-methyl-N-methylsulfanyl-1,3-thiazole-4-carboxamide (PubChem CID 145326794) has the molecular formula C20H15F3N4OS2 and a molecular weight of 448.50 g/mol. Its IUPAC name is 2-[4-cyano-N-[(2,3,5-trifluorophenyl)methyl]anilino]-5-methyl-N-methylsulfanyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[4-cyano-N-[(2,3,5-trifluorophenyl)methyl]anilino]-5-methyl-N-methylsulfanyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 145326794 |
| Molecular Formula | C20H15F3N4OS2 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 2-[4-cyano-N-[(2,3,5-trifluorophenyl)methyl]anilino]-5-methyl-N-methylsulfanyl-1,3-thiazole-4-carboxamide |
| SMILES | CSNC(=O)c1nc(N(Cc2cc(F)cc(F)c2F)c2ccc(C#N)cc2)sc1C |
| InChI | InChI=1S/C20H15F3N4OS2/c1-11-18(19(28)26-29-2)25-20(30-11)27(15-5-3-12(9-24)4-6-15)10-13-7-14(21)8-16(22)17(13)23/h3-8H,10H2,1-2H3,(H,26,28) |
| InChIKey | FLXYFIDXSXIMKY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|