C20H18N4O2S — CID 155028100
2-(N-benzyl-4-cyanoanilino)-5-methyl-N-methylsulfanyl-1,3-oxazole-4-carboxamide (PubChem CID 155028100) has the molecular formula C20H18N4O2S and a molecular weight of 378.46 g/mol. Its IUPAC name is 2-(N-benzyl-4-cyanoanilino)-5-methyl-N-methylsulfanyl-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(N-benzyl-4-cyanoanilino)-5-methyl-N-methylsulfanyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 155028100 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-(N-benzyl-4-cyanoanilino)-5-methyl-N-methylsulfanyl-1,3-oxazole-4-carboxamide |
| SMILES | CSNC(=O)c1nc(N(Cc2ccccc2)c2ccc(C#N)cc2)oc1C |
| InChI | InChI=1S/C20H18N4O2S/c1-14-18(19(25)23-27-2)22-20(26-14)24(13-16-6-4-3-5-7-16)17-10-8-15(12-21)9-11-17/h3-11H,13H2,1-2H3,(H,23,25) |
| InChIKey | IYHFYJCWMGXSTF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|