C12H13F3N4O — CID 133488581
N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-5-(trifluoromethoxy)pyridin-2-amine (PubChem CID 133488581) has the molecular formula C12H13F3N4O and a molecular weight of 286.26 g/mol. Its IUPAC name is N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-5-(trifluoromethoxy)pyridin-2-amine.
| Compound Name | N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-5-(trifluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 133488581 |
| Molecular Formula | C12H13F3N4O |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-5-(trifluoromethoxy)pyridin-2-amine |
| SMILES | CN(Cc1cnn(C)c1)c1ccc(OC(F)(F)F)cn1 |
| InChI | InChI=1S/C12H13F3N4O/c1-18(7-9-5-17-19(2)8-9)11-4-3-10(6-16-11)20-12(13,14)15/h3-6,8H,7H2,1-2H3 |
| InChIKey | LHZKRTQAVJXKIK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |