C13H14F3N3O3S — CID 39794988
N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 39794988) has the molecular formula C13H14F3N3O3S and a molecular weight of 349.33 g/mol. Its IUPAC name is N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 39794988 |
| Molecular Formula | C13H14F3N3O3S |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CN(Cc1cnn(C)c1)S(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3N3O3S/c1-18-8-10(7-17-18)9-19(2)23(20,21)12-5-3-11(4-6-12)22-13(14,15)16/h3-8H,9H2,1-2H3 |
| InChIKey | PTUUPIALTZIOEE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |