C12H16F3NO2 — CID 70831051
2-methoxy-N-methyl-N-[[4-(trifluoromethoxy)phenyl]methyl]ethanamine (PubChem CID 70831051) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 2-methoxy-N-methyl-N-[[4-(trifluoromethoxy)phenyl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-methyl-N-[[4-(trifluoromethoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 70831051 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2-methoxy-N-methyl-N-[[4-(trifluoromethoxy)phenyl]methyl]ethanamine |
| SMILES | COCCN(C)Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H16F3NO2/c1-16(7-8-17-2)9-10-3-5-11(6-4-10)18-12(13,14)15/h3-6H,7-9H2,1-2H3 |
| InChIKey | RELRKLPBZRMSJY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |